![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[IMG]](/icons/image2.gif){kind=icon}
.jpg){kind=link}
.png){kind=link}
.jpg){kind=link}
.jpg){kind=link}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| ele 2.png | 2023-11-20 12:29 | 6.4K | |
| ele 1.png | 2023-11-20 12:29 | 5.9K | |
| food web 1.png | 2023-11-20 12:29 | 2.3K | |
| aquarium n.png | 2023-11-20 12:29 | 4.6K | |
| national park n.png | 2023-11-20 12:29 | 5.3K | |
| zoo n.png | 2023-11-20 12:29 | 5.9K | |
| INCINERATOR a.png | 2023-11-20 12:29 | 4.5K | |
| plant trees more.png | 2023-11-20 12:29 | 6.0K | |
| organic food.png | 2023-11-20 12:29 | 6.0K | |
| single use plastic 1.png | 2023-11-20 12:29 | 4.6K | |
| plant pollinator friendly plant.png | 2023-11-20 12:29 | 4.9K | |
| migration of birds3.png | 2023-11-20 12:29 | 6.2K | |
| migration of animals 2.png | 2023-11-20 12:29 | 6.4K | |
| chipko movement 1.png | 2023-11-20 12:29 | 5.8K | |
| forests 3.png | 2023-11-20 12:29 | 5.1K | |
| forests 1.png | 2023-11-20 12:29 | 4.9K | |
| forest 5.png | 2023-11-20 12:29 | 6.0K | |
| forest 4.png | 2023-11-20 12:29 | 5.6K | |
| forest 2.png | 2023-11-20 12:29 | 5.1K | |
| vcmp.png | 2023-11-20 12:29 | 6.4K | |
| cmp.png | 2023-11-20 12:29 | 6.0K | |
| e.png | 2023-11-20 12:29 | 6.5K | |
| dumping.png | 2023-11-20 12:29 | 5.8K | |
| drain sys.png | 2023-11-20 12:29 | 5.1K | |
| drainage sysyt.png | 2023-11-20 12:29 | 5.1K | |
| industrial waste.jpg | 2023-11-20 12:29 | 1.9K | |
| e waste.png | 2023-11-20 12:29 | 6.5K | |
| DW.png | 2023-11-20 12:29 | 6.4K | |
| domestic waste.png | 2023-11-20 12:29 | 6.0K | |
| agricultural waste.jpg | 2023-11-20 12:29 | 2.0K | |
| swweage treatment plant.png | 2023-11-20 12:29 | 5.8K | |
| bushfires.jpg | 2023-11-20 12:29 | 1.5K | |
| mutal.png | 2023-11-20 12:29 | 5.6K | |
| commensalism.png | 2023-11-20 12:29 | 4.9K | |
| parasitism.png | 2023-11-20 12:29 | 3.1K | |
| commnesalism.png | 2023-11-20 12:29 | 5.1K | |
| Internal-structure-of-the-earth.png | 2023-11-20 12:29 | 1.6K | |
| predation.jpg | 2023-11-20 12:29 | 1.7K | |
| parasitsm.jpg | 2023-11-20 12:29 | 1.2K | |
| parasitism ii.jpg | 2023-11-20 12:29 | 1.4K | |
| mutualism.jpg | 2023-11-20 12:29 | 1.9K | |
| commenslaism.jpg | 2023-11-20 12:29 | 1.8K | |
| commensalism ii.jpg | 2023-11-20 12:29 | 1.2K | |
| competition.jpg | 2023-11-20 12:29 | 1.8K | |
| CamScanner 03-05-2021 12.jpg | 2023-11-20 12:29 | 1.4K | |
| biology_2.jpg | 2023-11-20 12:29 | 1.8K | |
| biology_1.jpg | 2023-11-20 12:29 | 1.7K | |
| our environment_1.jpg | 2023-11-20 12:29 | 1.7K | |
| our environment_2.jpg | 2023-11-20 12:29 | 1.5K | |
| our environment_3.jpg | 2023-11-20 12:29 | 1.5K | |
| weathering of rocks.jpg | 2023-11-20 12:29 | 1.7K | |
| types of soil 2.jpg | 2023-11-20 12:29 | 1.8K | |
| types of soil 1.jpg | 2023-11-20 12:29 | 2.1K | |
| soil profile.png | 2023-11-20 12:29 | 4.2K | |
| soil-formation.jpg | 2023-11-20 12:29 | 1.8K | |
| soil porfile 2i.jpg | 2023-11-20 12:29 | 1.6K | |
| soil pollution.jpg | 2023-11-20 12:29 | 2.3K | |
| soil new.jpg | 2023-11-20 12:29 | 1.9K | |
| soil erosion.jpg | 2023-11-20 12:29 | 1.5K | |
| soil erosion.jpeg | 2023-11-20 12:29 | 1.6K | |
| properties of soil.png | 2023-11-20 12:29 | 2.5K | |
| excretion in plants.jpg | 2023-11-20 12:29 | 1.9K | |
| soil composition.png | 2023-11-20 12:29 | 2.8K | |
| impact force new.jpg | 2023-11-20 12:29 | 1.8K | |
| mechanism of digestion (full alimentry canal ).jpg | 2023-11-20 12:29 | 1.6K | |
| KIDNEY.jpg | 2023-11-20 12:29 | 1.7K | |
| eXCRETORY SYSTEM.jpg | 2023-11-20 12:29 | 1.7K | |
| Climate.png | 2023-11-20 12:29 | 1.9K | |
| tissue culture.png | 2023-11-20 12:29 | 2.8K | |
| refraction glass slab.png | 2023-11-20 12:29 | 1.0K | |
| ray diagram converging lens.jpg | 2023-11-20 12:29 | 1.7K | |
| radical.jpg | 2023-11-20 12:29 | 1.4K | |
| kliedoscope.jpg | 2023-11-20 12:29 | 1.5K | |
| Plant Cell new.jpg | 2023-11-20 12:29 | 1.6K | |
| Fractioanl Distillation new.png | 2023-11-20 12:29 | 2.2K | |
| electrical conductivity of water(chemical effects of electric current).png | 2023-11-20 12:29 | 1.4K | |
| Distillation new.png | 2023-11-20 12:29 | 2.1K | |
| compound molecules.jpg | 2023-11-20 12:29 | 1.5K | |
| Chromatography Image.png | 2023-11-20 12:29 | 2.3K | |
| Cathode and Anode rays new.jpeg | 2023-11-20 12:29 | 1.5K | |
| Cathode Rays new.jpg | 2023-11-20 12:29 | 1.5K | |
| toucan.jpg | 2023-11-20 12:29 | 1.6K | |
| binary fission in ameoba new.jpg | 2023-11-20 12:29 | 1.4K | |
| Animal Cell new.jpg | 2023-11-20 12:29 | 1.7K | |
| reptiles 1.jpg | 2023-11-20 12:29 | 1.8K | |
| red eyed frog.jpg | 2023-11-20 12:29 | 1.5K | |
| malpigian tubules.jpg | 2023-11-20 12:29 | 1.7K | |
| kangroo.jpg | 2023-11-20 12:29 | 1.9K | |
| Hemodialysis.jpg | 2023-11-20 12:29 | 1.5K | |
| CAMEL.jpg | 2023-11-20 12:29 | 1.6K | |
| impulse.png | 2023-11-20 12:29 | 1.1K | |
| impact force.jpg | 2023-11-20 12:29 | 1.8K | |
| tropical rainfrest of the world.png | 2023-11-20 12:29 | 4.1K | |
| tropical pants.jpg | 2023-11-20 12:29 | 1.8K | |
| tropical animals.jpg | 2023-11-20 12:29 | 2.0K | |
| temperate palnts.jpg | 2023-11-20 12:29 | 1.8K | |
| temperate animals.jpg | 2023-11-20 12:29 | 2.0K | |
| STRUCTURE OF KIDNEY.jpg | 2023-11-20 12:29 | 1.7K | |
| rhino(N).jpg | 2023-11-20 12:29 | 1.6K | |
| SAMBHER(n).jpg | 2023-11-20 12:29 | 1.9K | |
| global consequences of deforestation.jpg | 2023-11-20 12:29 | 1.9K | |
| Extinct-Animals.jpg | 2023-11-20 12:29 | 2.0K | |
| NEELGAI.png | 2023-11-20 12:29 | 5.8K | |
