![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[IMG]](/icons/image2.gif){kind=icon}
![[DIR]](/icons/folder.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| diverging boundaries.jpg | 2023-07-20 22:45 | 63K | |
| Earthquake.png | 2023-07-20 22:45 | 6.3K | |
| Internal-structure-of-the-earth.png | 2023-07-20 22:45 | 27K | |
| fault lines.jpg | 2023-07-20 22:45 | 90K | |
| magnetic stripping image.jpg | 2023-07-20 22:45 | 61K | |
| great global rift system.jpg | 2023-07-20 22:45 | 51K | |
| ritting and continental drift.png | 2023-07-20 22:45 | 29K | |
| ice land.png | 2023-07-20 22:45 | 36K | |
| s.jpg | 2023-07-20 22:45 | 13K | |
| subduction.png | 2023-07-20 22:45 | 50K | |
| movement of paltes.png | 2023-07-20 22:45 | 97K | |
| Ques_1.jpg | 2023-07-20 22:45 | 166K | |
| tectoic plates.png | 2023-07-20 22:45 | 142K | |
| thumb/ | 2023-11-20 12:29 | - | |